Online Database of Chemicals from Around the World
| Rare Chemicals GmbH | Germany | Inquire | ||
|---|---|---|---|---|
 |
+49 (431) 5606-600 | |||
 |
info@rarechem.de | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,6-Dichloro-4-Nitrobenzoic Acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C7H3Cl2NO4 |
| Molecular Weight | 236.01 |
| CAS Registry Number | 22509-50-8 |
| SMILES | O=C(O)c1c(Cl)cc(cc1Cl)N(=O)=O |
| InChI | 1S/C7H3Cl2NO4/c8-4-1-3(10(13)14)2-5(9)6(4)7(11)12/h1-2H,(H,11,12) |
| InChIKey | UCVGAAAMGILBOD-UHFFFAOYSA-N |
| Density | 1.714g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.333°C at 760 mmHg (Cal.) |
| Flash point | 175.352°C (Cal.) |
| Refractive index | 1.638 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Dichloro-4-Nitrobenzoic Acid |