Online Database of Chemicals from Around the World
|
CAS#: 226-47-1 Product: 1,2,5,6-Dibenzophenazine No suppilers available for the product. |
| Name | 1,2,5,6-Dibenzophenazine |
|---|---|
| Synonyms | 1,2:5,6-Dibenzphenazine; 5-23-10-00184 (Beilstein Handbook Reference); 7,14-Diazadibenz(A,H)Anthracene |
| Molecular Structure |  |
| Molecular Formula | C20H12N2 |
| Molecular Weight | 280.33 |
| CAS Registry Number | 226-47-1 |
| SMILES | C1=CC3=C(C=C1)C2=NC5=C(N=C2C=C3)C4=CC=CC=C4C=C5 |
| InChI | 1S/C20H12N2/c1-3-7-15-13(5-1)9-11-17-19(15)21-18-12-10-14-6-2-4-8-16(14)20(18)22-17/h1-12H |
| InChIKey | WPBGTHBSULHLRG-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 544.08°C at 760 mmHg (Cal.) |
| Flash point | 251.323°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,5,6-Dibenzophenazine |