Online Database of Chemicals from Around the World
|
CAS#: 226-49-3 Product: Dipyrido[3,2-a:3',2'-h]phenazine No suppilers available for the product. |
| Name | Dipyrido[3,2-a:3',2'-h]phenazine |
|---|---|
| Molecular Structure | ![CAS#: 226-49-3， Dipyrido[3,2-a:3',2'-h]phenazine](/moreStructures/226-49-3.gif) |
| Molecular Formula | C18H10N4 |
| Molecular Weight | 282.30 |
| CAS Registry Number | 226-49-3 |
| SMILES | C5=CC1=C(C=CC2=C1N=C4C(=N2)C3=C(N=CC=C3)C=C4)N=C5 |
| InChI | 1S/C18H10N4/c1-3-11-13(19-9-1)5-7-15-17(11)21-16-8-6-14-12(18(16)22-15)4-2-10-20-14/h1-10H |
| InChIKey | ZQTUWSJRMFBEKF-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.912°C at 760 mmHg (Cal.) |
| Flash point | 271.392°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dipyrido[3,2-a:3',2'-h]phenazine |