Online Database of Chemicals from Around the World
|
CAS#: 2307-49-5 Product: 2,3,5-Trichloro-6-Methoxybenzoic Acid No suppilers available for the product. |
| Name | 2,3,5-Trichloro-6-Methoxybenzoic Acid |
|---|---|
| Synonyms | 2,3,5-Trichloro-6-Methoxy-Benzoic Acid; Benzoic Acid, 2,3,5-Trichloro-6-Methoxy-; 2-Methoxy-3,5,6-Trichlorobenzoic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H5Cl3O3 |
| Molecular Weight | 255.48 |
| CAS Registry Number | 2307-49-5 |
| EINECS | 218-985-2 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)C(O)=O)OC)Cl |
| InChI | 1S/C8H5Cl3O3/c1-14-7-4(10)2-3(9)6(11)5(7)8(12)13/h2H,1H3,(H,12,13) |
| InChIKey | WCLDITPGPXSPGV-UHFFFAOYSA-N |
| Density | 1.579g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.329°C at 760 mmHg (Cal.) |
| Flash point | 167.488°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5-Trichloro-6-Methoxybenzoic Acid |