Online Database of Chemicals from Around the World
|
CAS#: 2668-24-8 Product: 2,3,4-Trichloro-6-Methoxyphenol No suppilers available for the product. |
| Name | 2,3,4-Trichloro-6-Methoxyphenol |
|---|---|
| Synonyms | 2,3,4-Trichloro-6-Methoxy-Phenol; 4,5,6-Trichloroguaiacol; Brn 2524329 |
| Molecular Structure |  |
| Molecular Formula | C7H5Cl3O2 |
| Molecular Weight | 227.47 |
| CAS Registry Number | 2668-24-8 |
| SMILES | C1=C(C(=C(C(=C1OC)O)Cl)Cl)Cl |
| InChI | 1S/C7H5Cl3O2/c1-12-4-2-3(8)5(9)6(10)7(4)11/h2,11H,1H3 |
| InChIKey | NIAJPNQTKGWEOI-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.125°C at 760 mmHg (Cal.) |
| Flash point | 129.868°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4-Trichloro-6-Methoxyphenol |