Online Database of Chemicals from Around the World
|
CAS#: 23250-48-8 Product: alpha-Chloro-3,5-Diisopropyltoluene No suppilers available for the product. |
| Name | alpha-Chloro-3,5-Diisopropyltoluene |
|---|---|
| Synonyms | 1-(Chloromethyl)-3,5-Diisopropyl-Benzene; 1-(Chloromethyl)-3,5-Diisopropylbenzene; 3,5-Diisopropylbenzyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 |
| CAS Registry Number | 23250-48-8 |
| SMILES | C1=C(C=C(C=C1CCl)C(C)C)C(C)C |
| InChI | 1S/C13H19Cl/c1-9(2)12-5-11(8-14)6-13(7-12)10(3)4/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | NMWZQSCFUXEUOL-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 262.263°C at 760 mmHg (Cal.) |
| Flash point | 109.721°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Chloro-3,5-Diisopropyltoluene |