Online Database of Chemicals from Around the World
|
CAS#: 98184-19-1 Product: 1-Chloro-2,6-Diisopropyl-4-Methylbenzene No suppilers available for the product. |
| Name | 1-Chloro-2,6-Diisopropyl-4-Methylbenzene |
|---|---|
| Synonyms | 2-Chloro-1,3-Diisopropyl-5-Methyl-Benzene; 2-Chloro-1,3-Diisopropyl-5-Methylbenzene; 1-Chloro-2,6-Diisopropyl-4-Methylbenzene |
| Molecular Structure |  |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 |
| CAS Registry Number | 98184-19-1 |
| SMILES | C1=C(C(=C(C=C1C)C(C)C)Cl)C(C)C |
| InChI | 1S/C13H19Cl/c1-8(2)11-6-10(5)7-12(9(3)4)13(11)14/h6-9H,1-5H3 |
| InChIKey | WURDTYCULJKTHQ-UHFFFAOYSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.299°C at 760 mmHg (Cal.) |
| Flash point | 118.155°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2,6-Diisopropyl-4-Methylbenzene |