Online Database of Chemicals from Around the World
|
CAS#: 23306-60-7 Product: 4-(Ethylsulphonyl)-2-Nitroaniline No suppilers available for the product. |
| Name | 4-(Ethylsulphonyl)-2-Nitroaniline |
|---|---|
| Synonyms | 4-Ethylsulfonyl-2-Nitro-Aniline; (4-Ethylsulfonyl-2-Nitro-Phenyl)Amine; 2-Nitro-4-(Ethylsulfonyl)Aniline |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24 |
| CAS Registry Number | 23306-60-7 |
| EINECS | 245-568-2 |
| SMILES | C1=CC(=C(C=C1[S](=O)(=O)CC)[N+]([O-])=O)N |
| InChI | 1S/C8H10N2O4S/c1-2-15(13,14)6-3-4-7(9)8(5-6)10(11)12/h3-5H,2,9H2,1H3 |
| InChIKey | NAELBNIEPRXPCO-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.579°C at 760 mmHg (Cal.) |
| Flash point | 234.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Ethylsulphonyl)-2-Nitroaniline |