Online Database of Chemicals from Around the World
|
CAS#: 80036-85-7 Product: 4-(Ethylsulphonyl)-3-Nitroanisole No suppilers available for the product. |
| Name | 4-(Ethylsulphonyl)-3-Nitroanisole |
|---|---|
| Synonyms | 1-Ethylsulfonyl-4-Methoxy-2-Nitro-Benzene; 4-(Ethylsulphonyl)-3-Nitroanisole |
| Molecular Structure |  |
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.25 |
| CAS Registry Number | 80036-85-7 |
| EINECS | 279-374-4 |
| SMILES | C1=CC(=CC(=C1[S](CC)(=O)=O)[N+]([O-])=O)OC |
| InChI | 1S/C9H11NO5S/c1-3-16(13,14)9-5-4-7(15-2)6-8(9)10(11)12/h4-6H,3H2,1-2H3 |
| InChIKey | VFDSPCPEJJEKRS-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.841°C at 760 mmHg (Cal.) |
| Flash point | 225.251°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Ethylsulphonyl)-3-Nitroanisole |