Online Database of Chemicals from Around the World
|
CAS#: 23378-97-4 Product: 5-Chloro-2-Hydroxy-4-Methylbenzenesulfonyl Fluoride No suppilers available for the product. |
| Name | 5-Chloro-2-Hydroxy-4-Methylbenzenesulfonyl Fluoride |
|---|---|
| Synonyms | 2-Hydroxy-4-Methyl-5-Chlorobenzenesulfonyl Fluoride; 5-Chloro-2-Hydroxy-4-Methylbenzenesulfonyl Fluoride; Brn 2841806 |
| Molecular Structure |  |
| Molecular Formula | C7H6ClFO3S |
| Molecular Weight | 224.63 |
| CAS Registry Number | 23378-97-4 |
| SMILES | C1=C(C(=CC(=C1Cl)C)O)[S](=O)(=O)F |
| InChI | 1S/C7H6ClFO3S/c1-4-2-6(10)7(3-5(4)8)13(9,11)12/h2-3,10H,1H3 |
| InChIKey | JWFAESUCJZGWMS-UHFFFAOYSA-N |
| Density | 1.53g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.227°C at 760 mmHg (Cal.) |
| Flash point | 142.63°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-2-Hydroxy-4-Methylbenzenesulfonyl Fluoride |