Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Chloro-6-(Hydroxymethyl)-1,4-Benzoquinone |
|---|---|
| Synonyms | 2-chloro-6-(hydroxymethyl)cyclohexa-2,5-diene-1,4-dione |
| Molecular Structure |  |
| Molecular Formula | C7H5ClO3 |
| Molecular Weight | 172.57 |
| CAS Registry Number | 333344-08-4 |
| SMILES | O=C\1/C=C(/CO)C(=O)C(/Cl)=C/1 |
| InChI | 1S/C7H5ClO3/c8-6-2-5(10)1-4(3-9)7(6)11/h1-2,9H,3H2 |
| InChIKey | AGIRBSHCJNCQAK-UHFFFAOYSA-N |
| Density | 1.492g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.767°C at 760 mmHg (Cal.) |
| Flash point | 141.143°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-(Hydroxymethyl)-1,4-Benzoquinone |