|
CAS#: 23457-40-1 Product: 3,16,19-Trihydroxy-5-Androsten-17-One No suppilers available for the product. |
| Name | 3,16,19-Trihydroxy-5-Androsten-17-One |
|---|---|
| Synonyms | (8R,9S,10S,13S,14S)-3,16-Dihydroxy-13-Methyl-10-Methylol-1,2,3,4,7,8,9,11,12,14,15,16-Dodecahydrocyclopenta[A]Phenanthren-17-One; 3,16,19-Tao; 3,16,19-Trihydroxy-5-Androsten-17-One |
| Molecular Structure | ![]() |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 |
| CAS Registry Number | 23457-40-1 |
| SMILES | [C@@H]23CC=C1CC(CC[C@@]1([C@H]2CC[C@]4([C@H]3CC(C4=O)O)C)CO)O |
| InChI | 1S/C19H28O4/c1-18-6-5-14-13(15(18)9-16(22)17(18)23)3-2-11-8-12(21)4-7-19(11,14)10-20/h2,12-16,20-22H,3-10H2,1H3/t12?,13-,14+,15+,16?,18+,19-/m1/s1 |
| InChIKey | DAFZPRAMJKYZNI-DAZBISRNSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.916°C at 760 mmHg (Cal.) |
| Flash point | 284.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,16,19-Trihydroxy-5-Androsten-17-One |