Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,6-Trihydroxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,2,6-Trihydroxy-9,10-Anthraquinone; Chebi:37489; Nsc401141 |
| Molecular Structure |  |
| Molecular Formula | C14H8O5 |
| Molecular Weight | 256.21 |
| CAS Registry Number | 82-29-1 |
| SMILES | C1=C2C(=C(O)C(=C1)O)C(=O)C3=C(C2=O)C=C(O)C=C3 |
| InChI | 1S/C14H8O5/c15-6-1-2-7-9(5-6)12(17)8-3-4-10(16)14(19)11(8)13(7)18/h1-5,15-16,19H |
| InChIKey | QWPVOAUJFKGLQA-UHFFFAOYSA-N |
| Density | 1.66g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.972°C at 760 mmHg (Cal.) |
| Flash point | 247.312°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,6-Trihydroxyanthracene-9,10-Dione |