Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (4R,6S)-2,4-Dimethoxy-6-Methyltetrahydro-2H-Pyran |
|---|---|
| Synonyms | (4R,6S)-2,4-dimethoxy-6-methyltetrahydro-2H-pyran |
| Molecular Structure |  |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 |
| CAS Registry Number | 237056-36-9 |
| SMILES | O([C@@H]1C[C@@H](OC(OC)C1)C)C |
| InChI | 1S/C8H16O3/c1-6-4-7(9-2)5-8(10-3)11-6/h6-8H,4-5H2,1-3H3/t6-,7+,8?/m0/s1 |
| InChIKey | FBZVZMDKKTZELT-KJFJCRTCSA-N |
| Density | 0.982g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.884°C at 760 mmHg (Cal.) |
| Flash point | 62.425°C (Cal.) |
| Refractive index | 1.431 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R,6S)-2,4-Dimethoxy-6-Methyltetrahydro-2H-Pyran |