|
CAS#: 24058-92-2 Product: 1,5-Diphenyl-1H-[1,2,4]Triazole-3-Carboxylic Acid No suppilers available for the product. |
| Name | 1,5-Diphenyl-1H-[1,2,4]Triazole-3-Carboxylic Acid |
|---|---|
| Synonyms | Zinc00151998 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N3O2 |
| Molecular Weight | 264.26 |
| CAS Registry Number | 24058-92-2 |
| SMILES | C3=C([N]1N=C(N=C1C2=CC=CC=C2)C([O-])=O)C=CC=C3 |
| InChI | 1S/C15H11N3O2/c19-15(20)13-16-14(11-7-3-1-4-8-11)18(17-13)12-9-5-2-6-10-12/h1-10H,(H,19,20)/p-1 |
| InChIKey | RBJKFWPNGGRTOV-UHFFFAOYSA-M |
| Boiling point | 525.721°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 271.746°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,5-Diphenyl-1H-[1,2,4]Triazole-3-Carboxylic Acid |