| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1,1,1,3,3,3-Hexafluoro-2-(Trifluoromethyl)-2-Propanyl Trifluoroacetate |
|---|---|
| Synonyms | 1,1,1,3,3 |
| Molecular Structure | ![]() |
| Molecular Formula | C6F12O2 |
| Molecular Weight | 332.04 |
| CAS Registry Number | 24165-10-4 |
| SMILES | FC(F)(F)C(OC(=O)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C6F12O2/c7-2(8,9)1(19)20-3(4(10,11)12,5(13,14)15)6(16,17)18 |
| InChIKey | FXSOHPXIFIETIO-UHFFFAOYSA-N |
| Density | 1.688g/cm3 (Cal.) |
|---|---|
| Boiling point | 49.936°C at 760 mmHg (Cal.) |
| Flash point | -14.005°C (Cal.) |
| Refractive index | 1.27 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,3,3-Hexafluoro-2-(Trifluoromethyl)-2-Propanyl Trifluoroacetate |