Online Database of Chemicals from Around the World
| Name | Hexafluoro-DL-Valine |
|---|---|
| Synonyms | 2-Amino-4,4,4-Trifluoro-3-(Trifluoromethyl)Butyric Acid; Hexafluorovaline |
| Molecular Structure |  |
| Molecular Formula | C5H5F6NO2 |
| Molecular Weight | 225.09 |
| CAS Registry Number | 759-12-6 |
| EINECS | 240-207-5 |
| SMILES | O=C(C(C(C(F)(F)F)C(F)(F)F)N)O |
| InChI | 1S/C5H5F6NO2/c6-4(7,8)2(5(9,10)11)1(12)3(13)14/h1-2H,12H2,(H,13,14) |
| InChIKey | KRNSHCKTGFAMPQ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 204°C (Expl.) |
| Boiling point | 165.9±40.0°C at 760 mmHg (Cal.) |
| Flash point | 110°C (Expl.) |
| 54.1±27.3°C (Cal.) | |
| Market Analysis Reports |
| List of Reports Available for Hexafluoro-DL-Valine |
