Online Database of Chemicals from Around the World
| Name | 1,8-Diisopropylnaphthalene |
|---|---|
| Synonyms | 1,8-Diisopropylnaphthalene; Naphthalene, 1,8-Bis(1-Methylethyl)- |
| Molecular Structure |  |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 24192-58-3 |
| EINECS | 246-070-8 |
| SMILES | C1=CC(=C2C(=C1)C=CC=C2C(C)C)C(C)C |
| InChI | 1S/C16H20/c1-11(2)14-9-5-7-13-8-6-10-15(12(3)4)16(13)14/h5-12H,1-4H3 |
| InChIKey | MXPFNCSRRZDGMJ-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.805°C at 760 mmHg (Cal.) |
| Flash point | 142.537°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Diisopropylnaphthalene |
