Online Database of Chemicals from Around the World
|
CAS#: 94133-81-0 Product: 2,3-Diisopropylnaphthalene No suppilers available for the product. |
| Name | 2,3-Diisopropylnaphthalene |
|---|---|
| Synonyms | 2,3-Diisopropylnaphthalene |
| Molecular Structure |  |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.33 |
| CAS Registry Number | 94133-81-0 |
| EINECS | 302-744-4 |
| SMILES | C1=C2C(=CC(=C1C(C)C)C(C)C)C=CC=C2 |
| InChI | 1S/C16H20/c1-11(2)15-9-13-7-5-6-8-14(13)10-16(15)12(3)4/h5-12H,1-4H3 |
| InChIKey | VHLCCRACDZFEFS-UHFFFAOYSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.185°C at 760 mmHg (Cal.) |
| Flash point | 138.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Diisopropylnaphthalene |