Online Database of Chemicals from Around the World
| Name | Isopropylidene(Tetramethyl)Cyclopropane |
|---|---|
| Synonyms | 1,1,2,2-Tetramethyl-3-(1-methylethylidene)cyclopropane #; Cyclopropane, tetramethylpropylidene- |
| Molecular Structure |  |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 |
| CAS Registry Number | 24519-04-8 |
| SMILES | C(=C1/C(C)(C)C1(C)C)(\C)C |
| InChI | 1S/C10H18/c1-7(2)8-9(3,4)10(8,5)6/h1-6H3 |
| InChIKey | RFGCCDPGRGJAOI-UHFFFAOYSA-N |
| Density | 0.804g/cm3 (Cal.) |
|---|---|
| Boiling point | 138.21°C at 760 mmHg (Cal.) |
| Flash point | 28.117°C (Cal.) |
| Refractive index | 1.447 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropylidene(Tetramethyl)Cyclopropane |
