Online Database of Chemicals from Around the World
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (919) 678-0702 | |||
 |
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | (2xi)-1,2-O-Isopropylidene-D-Ribo-Hexofuranose |
|---|---|
| Synonyms | 1,2-O-isopropylidene-D-allofuranose |
| Molecular Structure |  |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 |
| CAS Registry Number | 4495-04-9 |
| SMILES | OCC(O)[C@H]1OC2OC(C)(C)OC2[C@@H]1O |
| InChI | 1S/C9H16O6/c1-9(2)14-7-5(12)6(4(11)3-10)13-8(7)15-9/h4-8,10-12H,3H2,1-2H3/t4?,5-,6-,7?,8?/m1/s1 |
| InChIKey | BGGCXQKYCBBHAH-DMIPUTKBSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.43°C at 760 mmHg (Cal.) |
| Flash point | 209.279°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2xi)-1,2-O-Isopropylidene-D-Ribo-Hexofuranose |