Online Database of Chemicals from Around the World
| Name | 4,5-Dibromosalicylanilide |
|---|---|
| Synonyms | 4,5-Dibromo-2-Hydroxy-N-Phenyl-Benzamide; 4,5-Dibromosalicylanilide; Benzamide, 4,5-Dibromo-2-Hydroxy-N-Phenyl- |
| Molecular Structure |  |
| Molecular Formula | C13H9Br2NO2 |
| Molecular Weight | 371.03 |
| CAS Registry Number | 24556-64-7 |
| EINECS | 246-310-1 |
| SMILES | C1=C(O)C(=CC(=C1Br)Br)C(=O)NC2=CC=CC=C2 |
| InChI | 1S/C13H9Br2NO2/c14-10-6-9(12(17)7-11(10)15)13(18)16-8-4-2-1-3-5-8/h1-7,17H,(H,16,18) |
| InChIKey | NLQGPXRZRKLYEC-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.165°C at 760 mmHg (Cal.) |
| Flash point | 193.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dibromosalicylanilide |
