|
CAS#: 24595-14-0 Product: L-Glutamic Acid Monopotassium Salt No suppilers available for the product. |
| Classification | Biochemical >> Common amino acids and protein drugs |
|---|---|
| Name | L-Glutamic Acid Monopotassium Salt |
| Synonyms | Dipotassium (2S)-2-Aminoglutarate |
| Molecular Structure | ![]() |
| Molecular Formula | C5H7K2NO4 |
| Molecular Weight | 223.31 |
| CAS Registry Number | 24595-14-0 |
| EINECS | 246-336-3 |
| SMILES | [C@@H](N)(C([O-])=O)CCC([O-])=O.[K+].[K+] |
| InChI | 1S/C5H9NO4.2K/c6-3(5(9)10)1-2-4(7)8;;/h3H,1-2,6H2,(H,7,8)(H,9,10);;/q;2*+1/p-2/t3-;;/m0../s1 |
| InChIKey | WDRWZVWLVBXVOI-QTNFYWBSSA-L |
| Boiling point | 333.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Glutamic Acid Monopotassium Salt |