|
CAS#: 2461-83-8 Product: 1,4-Bis(4-Bromophenyl)Butane-1,4-Dione No suppilers available for the product. |
| Name | 1,4-Bis(4-Bromophenyl)Butane-1,4-Dione |
|---|---|
| Synonyms | 1,4-Butanedione, 1,4-Bis(4-Bromophenyl)-; Nsc222; 1,4-Bis(4-Bromophenyl)-1,4-Butanedione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12Br2O2 |
| Molecular Weight | 396.08 |
| CAS Registry Number | 2461-83-8 |
| SMILES | C1=C(C=CC(=C1)Br)C(=O)CCC(=O)C2=CC=C(Br)C=C2 |
| InChI | 1S/C16H12Br2O2/c17-13-5-1-11(2-6-13)15(19)9-10-16(20)12-3-7-14(18)8-4-12/h1-8H,9-10H2 |
| InChIKey | VOJRFGKKQMVGPH-UHFFFAOYSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.106°C at 760 mmHg (Cal.) |
| Flash point | 141.646°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Bis(4-Bromophenyl)Butane-1,4-Dione |