|
CAS#: 55282-25-2 Product: 2,2-Bis[(4-Bromophenyl)Amino]-1-Phenylethanone No suppilers available for the product. |
| Name | 2,2-Bis[(4-Bromophenyl)Amino]-1-Phenylethanone |
|---|---|
| Synonyms | 2,2-Bis[(4-Bromophenyl)Amino]-1-Phenyl-Ethanone; Nsc105674; 2,2-Bis(4-Bromoanilino)-1-Phenylethanone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16Br2N2O |
| Molecular Weight | 460.17 |
| CAS Registry Number | 55282-25-2 |
| SMILES | C3=C(NC(NC1=CC=C(Br)C=C1)C(=O)C2=CC=CC=C2)C=CC(=C3)Br |
| InChI | 1S/C20H16Br2N2O/c21-15-6-10-17(11-7-15)23-20(19(25)14-4-2-1-3-5-14)24-18-12-8-16(22)9-13-18/h1-13,20,23-24H |
| InChIKey | NDSNCENRGYAOQP-UHFFFAOYSA-N |
| Density | 1.635g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.937°C at 760 mmHg (Cal.) |
| Flash point | 328.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Bis[(4-Bromophenyl)Amino]-1-Phenylethanone |