Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,4-Dimethoxy-6-Phenoxypyrimidine |
|---|---|
| Synonyms | 2,4-dimethoxy-6-phenoxypyrimidine |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 |
| CAS Registry Number | 246538-87-4 |
| SMILES | COc1cc(nc(n1)OC)Oc2ccccc2 |
| InChI | 1S/C12H12N2O3/c1-15-10-8-11(14-12(13-10)16-2)17-9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | DYEYSARIEKVUQZ-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.604°C at 760 mmHg (Cal.) |
| Flash point | 135.367°C (Cal.) |
| Refractive index | 1.553 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethoxy-6-Phenoxypyrimidine |