Online Database of Chemicals from Around the World
|
CAS#: 33576-92-0 Product: Dimethoxy-(Phenoxy)-Sulfanylidenephosphorane No suppilers available for the product. |
| Name | Dimethoxy-(Phenoxy)-Sulfanylidenephosphorane |
|---|---|
| Synonyms | Dimethoxy-(Phenoxy)-Thioxo-Phosphorane; Dimethoxy-(Phenoxy)-Thioxophosphorane; Dimethoxy-(Phenoxy)-Sulfanylidene-Phosphorane |
| Molecular Structure |  |
| Molecular Formula | C8H11O3PS |
| Molecular Weight | 218.21 |
| CAS Registry Number | 33576-92-0 |
| SMILES | C1=CC=CC=C1O[P](OC)(=S)OC |
| InChI | 1S/C8H11O3PS/c1-9-12(13,10-2)11-8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | PZZAINQLAOZPRL-UHFFFAOYSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.136°C at 760 mmHg (Cal.) |
| Flash point | 104.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethoxy-(Phenoxy)-Sulfanylidenephosphorane |