Online Database of Chemicals from Around the World
| Name | 4,5,7,8-Tetrahydroxynaphthalene-1,2-Dione |
|---|---|
| Synonyms | 4,5,7,8-Tetrahydroxy-1,2-Naphthoquinone; 1,4-Naphthalenedione, 2,5,7,8-Tetrahydroxy-; 2,5,7,8-Tetrahydroxy-1,4-Naphthalenedione |
| Molecular Structure |  |
| Molecular Formula | C10H6O6 |
| Molecular Weight | 222.15 |
| CAS Registry Number | 2473-16-7 |
| SMILES | C1=C(O)C2=C(C(=C1O)O)C(=O)C(=O)C=C2O |
| InChI | 1S/C10H6O6/c11-3-1-5(13)9(15)8-7(3)4(12)2-6(14)10(8)16/h1-2,11-13,15H |
| InChIKey | PEEIVTDTCNXCLB-UHFFFAOYSA-N |
| Density | 1.969g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.56°C at 760 mmHg (Cal.) |
| Flash point | 324.993°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,7,8-Tetrahydroxynaphthalene-1,2-Dione |
