Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3,5,7-Tetrahydroxy-1,4-Naphthalenedione |
|---|---|
| Synonyms | 1,4,5,7-Tetrahydroxy-2,3-Naphthoquinone; Nsc288042; Spinochrome B (An) |
| Molecular Structure |  |
| Molecular Formula | C10H6O6 |
| Molecular Weight | 222.15 |
| CAS Registry Number | 604-46-6 |
| SMILES | O=C1C(=C2C(=C(O)C1=O)C=C(O)C=C2O)O |
| InChI | 1S/C10H6O6/c11-3-1-4-6(5(12)2-3)8(14)10(16)9(15)7(4)13/h1-2,11-14H |
| InChIKey | JHMLTYYMTQKQHH-UHFFFAOYSA-N |
| Density | 1.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.981°C at 760 mmHg (Cal.) |
| Flash point | 181.47°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,7-Tetrahydroxy-1,4-Naphthalenedione |