Identification
| Classification |
Catalysts and additives >> Polymer |
| Name |
Methacrylic Acid Butyl Ester Polymer With 2-(Dimethylamino)Ethyl Meth-Acrylate And Methyl Methacrylate |
| Synonyms |
2-Methylprop-2-Enoic Acid Butyl Ester; 2-Methylprop-2-Enoic Acid 2-Dimethylaminoethyl Ester; 2-Methylprop-2-Enoic Acid Methyl Ester; 2-Methylacrylic Acid Butyl Ester; 2-Methylacrylic Acid 2-Dimethylaminoethyl Ester; 2-Methylacrylic Acid Methyl Ester |
|
| Molecular Structure |
 |
| Molecular Formula |
C21H37NO6 |
| Molecular Weight |
399.53 |
| CAS Registry Number |
24938-16-7 |
| SMILES |
C(OC(=O)C(=C)C)CN(C)C.C(OC(=O)C(=C)C)CCC.CC(C(OC)=O)=C |
| InChI |
1S/C8H15NO2.C8H14O2.C5H8O2/c1-7(2)8(10)11-6-5-9(3)4;1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3/h1,5-6H2,2-4H3;2,4-6H2,1,3H3;1H2,2-3H3 |
| InChIKey |
NEDGUIRITORSKL-UHFFFAOYSA-N |
|