Online Database of Chemicals from Around the World
|
CAS#: 2539-26-6 Product: 3,4,5-Trichloro-2,6-Dimethoxyphenol No suppilers available for the product. |
| Name | 3,4,5-Trichloro-2,6-Dimethoxyphenol |
|---|---|
| Synonyms | 3,4,5-Trichloro-2,6-Dimethoxy-Phenol; 2,6-Dimethoxy-3,4,5-Trichlorophenol; Ccris 4060 |
| Molecular Structure |  |
| Molecular Formula | C8H7Cl3O3 |
| Molecular Weight | 257.50 |
| CAS Registry Number | 2539-26-6 |
| SMILES | COC1=C(C(=C(Cl)C(=C1Cl)Cl)OC)O |
| InChI | 1S/C8H7Cl3O3/c1-13-7-4(10)3(9)5(11)8(14-2)6(7)12/h12H,1-2H3 |
| InChIKey | ZZCSBXFJFLSDRR-UHFFFAOYSA-N |
| Density | 1.5g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.201°C at 760 mmHg (Cal.) |
| Flash point | 157.734°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Trichloro-2,6-Dimethoxyphenol |