Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,2,2-Trichloro-1-(4,5-dihydro-3-furanyl)ethanone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C6H5Cl3O2 |
| Molecular Weight | 215.46 |
| CAS Registry Number | 83124-80-5 |
| SMILES | ClC(Cl)(Cl)C(=O)\C1=C\OCC1 |
| InChI | 1S/C6H5Cl3O2/c7-6(8,9)5(10)4-1-2-11-3-4/h3H,1-2H2 |
| InChIKey | XJHUPUJCESXRQR-UHFFFAOYSA-N |
| Density | 1.578g/cm3 (Cal.) |
|---|---|
| Boiling point | 204.776°C at 760 mmHg (Cal.) |
| Flash point | 79.631°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,2-Trichloro-1-(4,5-dihydro-3-furanyl)ethanone |