Online Database of Chemicals from Around the World
|
CAS#: 25561-37-9 Product: 4'-(Phenylthio)-alpha-(Piperidinoimino)Acetophenone No suppilers available for the product. |
| Name | 4'-(Phenylthio)-alpha-(Piperidinoimino)Acetophenone |
|---|---|
| Synonyms | (2E)-1-(4-Phenylsulfanylphenyl)-2-(1-Piperidylimino)Ethanone; (2E)-1-[4-(Phenylthio)Phenyl]-2-(1-Piperidylimino)Ethanone; (2E)-1-[4-(Phenylthio)Phenyl]-2-Piperidinoimino-Ethanone |
| Molecular Structure |  |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.44 |
| CAS Registry Number | 25561-37-9 |
| SMILES | C2=C(C(=O)/C=N/N1CCCCC1)C=CC(=C2)SC3=CC=CC=C3 |
| InChI | 1S/C19H20N2OS/c22-19(15-20-21-13-5-2-6-14-21)16-9-11-18(12-10-16)23-17-7-3-1-4-8-17/h1,3-4,7-12,15H,2,5-6,13-14H2/b20-15+ |
| InChIKey | YPWRHVFSFBFBKF-HMMYKYKNSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.928°C at 760 mmHg (Cal.) |
| Flash point | 257.962°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-(Phenylthio)-alpha-(Piperidinoimino)Acetophenone |