Online Database of Chemicals from Around the World
| Dalton Pharma Services | Canada | Inquire | ||
|---|---|---|---|---|
 |
+1 (416) 661-2102 | |||
 |
chemist@dalton.com | |||
| Chemical manufacturer | ||||
| Name | 6-(Phenylthio)Purine |
|---|---|
| Synonyms | 6-(Phenylthio)-7H-Purine; 1H-Purine, 6-(Phenylthio)-; 4-26-00-01985 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C11H8N4S |
| Molecular Weight | 228.27 |
| CAS Registry Number | 5450-35-1 |
| SMILES | C3=NC1=C(C(=NC=N1)SC2=CC=CC=C2)[NH]3 |
| InChI | 1S/C11H8N4S/c1-2-4-8(5-3-1)16-11-9-10(13-6-12-9)14-7-15-11/h1-7H,(H,12,13,14,15) |
| InChIKey | CTDPZFBZKUUAED-UHFFFAOYSA-N |
| Density | 1.457g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.089°C at 760 mmHg (Cal.) |
| Flash point | 272.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(Phenylthio)Purine |