Online Database of Chemicals from Around the World
| Name | Bis(Chloromethyl)Xylene |
|---|---|
| Synonyms | 1,2-Bis(Chloromethyl)-3,4-Dimethyl-Benzene; Benzene, Bis(Chloromethyl)Dimethyl-; Bis(Chloromethyl)Dimethylbenzene |
| Molecular Structure |  |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 |
| CAS Registry Number | 25640-76-0 |
| SMILES | C1=C(C(=C(C(=C1)C)C)CCl)CCl |
| InChI | 1S/C10H12Cl2/c1-7-3-4-9(5-11)10(6-12)8(7)2/h3-4H,5-6H2,1-2H3 |
| InChIKey | SQFQIHCPTTUZCP-UHFFFAOYSA-N |
| Density | 1.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.143°C at 760 mmHg (Cal.) |
| Flash point | 140.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Chloromethyl)Xylene |
