| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,5-Bis(Chloromethyl)-p-Xylene |
|---|---|
| Synonyms | 1,4-Bis(Chloromethyl)-2,5-Dimethyl-Benzene; 2,5-Di(Chloromethyl)-P-Xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 |
| CAS Registry Number | 6298-72-2 |
| EINECS | 228-575-5 |
| SMILES | C1=C(C)C(=CC(=C1CCl)C)CCl |
| InChI | 1S/C10H12Cl2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | UYRPOMMBPQHVMN-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 130-133°C (Expl.) |
| Boiling point | 291.5±35.0°C at 760 mmHg (Cal.) |
| Flash point | 142.2±19.3°C (Cal.) |
| Safety Code | S20;S26;S36/37/39;S45 Details |
|---|---|
| Risk Code | R34 Details |
| Hazard Symbol | C Details |
| Transport Information | UN1759 |
| Safety Description | DANGER: CORROSIVE, burns skin and eyes |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(Chloromethyl)-p-Xylene |