|
CAS#: 25683-07-2 Product: Pyoluteorin No suppilers available for the product. |
| Name | Pyoluteorin |
|---|---|
| Synonyms | Nsc143092; Wln: T5mj Bg Cg Evr Bq Fq; 5-21-13-00199 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Cl2NO3 |
| Molecular Weight | 272.09 |
| CAS Registry Number | 25683-07-2 |
| SMILES | C1=C([NH]C(=C1Cl)Cl)C(C2=C(O)C=CC=C2O)=O |
| InChI | 1S/C11H7Cl2NO3/c12-5-4-6(14-11(5)13)10(17)9-7(15)2-1-3-8(9)16/h1-4,14-16H |
| InChIKey | JPGWTZORMBTNMF-UHFFFAOYSA-N |
| Density | 1.633g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.855°C at 760 mmHg (Cal.) |
| Flash point | 218.002°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Pyoluteorin |