Online Database of Chemicals from Around the World
|
CAS#: 2589-15-3 Product: 1,4,5,6,7,8,8-Heptachloro-3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Indene No suppilers available for the product. |
| Name | 1,4,5,6,7,8,8-Heptachloro-3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Indene |
|---|---|
| Synonyms | 4,7-Methano-1H-Indene, 1,4,5,6,7,8,8-Heptachloro-3A,4,5,6,7,7A-Hexahydro-; 4,7-Methanoindan, 1,4,5,6,7,8,8-Heptachloro-3A,4,7,7A-Tetrahydro-; Brn 2508155 |
| Molecular Structure |  |
| Molecular Formula | C10H7Cl7 |
| Molecular Weight | 375.34 |
| CAS Registry Number | 2589-15-3 |
| SMILES | C3C2C1(C(C(C(=C1Cl)Cl)(C2C(C3)Cl)Cl)(Cl)Cl)Cl |
| InChI | 1S/C10H7Cl7/c11-4-2-1-3-5(4)9(15)7(13)6(12)8(3,14)10(9,16)17/h3-5H,1-2H2 |
| InChIKey | DRKYTUDHOKREMS-UHFFFAOYSA-N |
| Density | 1.75g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.181°C at 760 mmHg (Cal.) |
| Flash point | 189.429°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4,5,6,7,8,8-Heptachloro-3a,4,5,6,7,7alpha-Hexahydro-4,7-Methano-1H-Indene |