Online Database of Chemicals from Around the World
|
CAS#: 32241-08-0 Product: 1,2,3,4,5,6,8-Heptachloronaphthalene No suppilers available for the product. |
| Name | 1,2,3,4,5,6,8-Heptachloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,3,4,5,6,8-Heptachloro-; Naphthalene, 1,2,3,4,5,6,8-Heptachloro |
| Molecular Structure |  |
| Molecular Formula | C10HCl7 |
| Molecular Weight | 369.29 |
| CAS Registry Number | 32241-08-0 (58863-15-3) |
| EINECS | 250-969-0 |
| SMILES | C2=C(C1=C(C(=C(C(=C1C(=C2Cl)Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C10HCl7/c11-2-1-3(12)6(13)5-4(2)7(14)9(16)10(17)8(5)15/h1H |
| InChIKey | QYEGXUUXWMKHHS-UHFFFAOYSA-N |
| Density | 1.782g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.483°C at 760 mmHg (Cal.) |
| Flash point | 208.379°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6,8-Heptachloronaphthalene |