| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| OX CHEM | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Ethyl 2-Amino-3,5,6-Trifluoroisonicotinate |
|---|---|
| Synonyms | 2-Amino-3 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 |
| CAS Registry Number | 259675-84-8 |
| SMILES | CCOC(=O)c1c(c(nc(c1F)F)N)F |
| InChI | 1S/C8H7F3N2O2/c1-2-15-8(14)3-4(9)6(11)13-7(12)5(3)10/h2H2,1H3,(H2,12,13) |
| InChIKey | UPKXZLOECBXQAY-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.219°C at 760 mmHg (Cal.) |
| Flash point | 145.649°C (Cal.) |
| Refractive index | 1.504 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-Amino-3,5,6-Trifluoroisonicotinate |