Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | ethyl 4-amino-3-(trifluoromethyl)benzoate |
|---|---|
| Synonyms | Ethyl 4-amino-3-(trifluoromethyl)benzoate |
| Molecular Structure |  |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 |
| CAS Registry Number | 688020-69-1 |
| SMILES | CCOC(=O)c1ccc(c(c1)C(F)(F)F)N |
| InChI | 1S/C10H10F3NO2/c1-2-16-9(15)6-3-4-8(14)7(5-6)10(11,12)13/h3-5H,2,14H2,1H3 |
| InChIKey | VWPNIUJAKBOMJD-UHFFFAOYSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.302°C at 760 mmHg (Cal.) |
| Flash point | 146.909°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ethyl 4-amino-3-(trifluoromethyl)benzoate |