Online Database of Chemicals from Around the World
| Name | Dichloro-Bis(Trichloromethyl)Silane |
|---|---|
| Synonyms | Dichlorobis(Trichloromethyl)Silane |
| Molecular Structure |  |
| Molecular Formula | C2Cl8Si |
| Molecular Weight | 335.73 |
| CAS Registry Number | 2602-55-3 |
| EINECS | 220-013-7 |
| SMILES | Cl[Si](C(Cl)(Cl)Cl)(C(Cl)(Cl)Cl)Cl |
| InChI | 1S/C2Cl8Si/c3-1(4,5)11(9,10)2(6,7)8 |
| InChIKey | DCAHYUQEYDTBOH-UHFFFAOYSA-N |
| Density | 1.781g/cm3 (Cal.) |
|---|---|
| Boiling point | 213.886°C at 760 mmHg (Cal.) |
| Flash point | 84.668°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro-Bis(Trichloromethyl)Silane |
