| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Benzene-1,4-Diamine, Benzene-1,4-Dicarbonyl Chloride |
|---|---|
| Synonyms | Benzene-1,4-Dicarbonyl Chloride; P-Phenylenediamine; 1,4-Benzenedicarbonyl Dichloride, Polymer With 1,4-Benzenediamine; 1,4-Benzenedicaronyl Dichloride, Polymer With 1,4-Benzenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 |
| CAS Registry Number | 26125-61-1 |
| SMILES | C1=C(C=CC(=C1)C(Cl)=O)C(Cl)=O.C2=C(N)C=CC(=C2)N |
| InChI | 1S/C8H4Cl2O2.C6H8N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;7-5-1-2-6(8)4-3-5/h1-4H;1-4H,7-8H2 |
| InChIKey | KIEIYPCTMJWBOD-UHFFFAOYSA-N |
| Boiling point | 266°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 143.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzene-1,4-Diamine, Benzene-1,4-Dicarbonyl Chloride |