Online Database of Chemicals from Around the World
|
CAS#: 26430-30-8 Product: Carpanone No suppilers available for the product. |
| Name | Carpanone |
|---|---|
| Synonyms | Cupanone; Nsc156298 |
| Molecular Structure |  |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 |
| CAS Registry Number | 26430-30-8 |
| SMILES | C1=C6C(=CC4=C1C2C3C(=CC(C)C2C)C(C=C5C3(O4)OCO5)=O)OCO6 |
| InChI | 1S/C20H18O6/c1-9-3-11-13(21)5-17-20(25-8-24-17)19(11)18(10(9)2)12-4-15-16(23-7-22-15)6-14(12)26-20/h3-6,9-10,18-19H,7-8H2,1-2H3 |
| InChIKey | WTXORUUTAZJKSN-UHFFFAOYSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.274°C at 760 mmHg (Cal.) |
| Flash point | 235.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carpanone |