|
CAS#: 18464-39-6 Product: Caroxazone No suppilers available for the product. |
| Name | Caroxazone |
|---|---|
| Synonyms | 2-(2-Keto-4H-1,3-Benzoxazin-3-Yl)Acetamide; 2-(2-Oxo-4H-1,3-Benzoxazin-3-Yl)Ethanamide; 2-Oxo-2H-1,3-Benzoxazine-3(4H)-Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 |
| CAS Registry Number | 18464-39-6 |
| EINECS | 242-345-1 |
| SMILES | C1=CC=CC2=C1CN(CC(N)=O)C(O2)=O |
| InChI | 1S/C10H10N2O3/c11-9(13)6-12-5-7-3-1-2-4-8(7)15-10(12)14/h1-4H,5-6H2,(H2,11,13) |
| InChIKey | KYCBWEZLKCTALM-UHFFFAOYSA-N |
| Density | 1.346g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.052°C at 760 mmHg (Cal.) |
| Flash point | 216.912°C (Cal.) |
| (1) | J. Wouters, G. Evrard and F. Durant. The molecular structure of caroxazone, a reversible monoamine oxidase inhibitor, Acta Cryst. (1994). C50, 1774-1777 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Caroxazone |