Online Database of Chemicals from Around the World
|
CAS#: 26671-58-9 Product: 5-Deoxyinositol No suppilers available for the product. |
| Name | 5-Deoxyinositol |
|---|---|
| Synonyms | 5-Deoxyinositol; Myo-Inositol, 5-Deoxy- |
| Molecular Structure |  |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 |
| CAS Registry Number | 26671-58-9 |
| SMILES | [C@@H]1(O)C(O)[C@H](O)[C@@H](O)C[C@H]1O |
| InChI | 1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3+,4+,5-,6? |
| InChIKey | IMPKVMRTXBRHRB-KFJBKXNJSA-N |
| Density | 1.796g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.641°C at 760 mmHg (Cal.) |
| Flash point | 146.216°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Deoxyinositol |