Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2-Deoxyinosose |
|---|---|
| Synonyms | (2R,3S,4R,5S)-2,3,4,5-Tetrahydroxy-1-Cyclohexanone; 2-Deoxy-Scyllo-Inosose; 2-Deoxyinosose |
| Molecular Structure |  |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 |
| CAS Registry Number | 61914-09-8 |
| SMILES | [C@H]1([C@H](C(C[C@@H]([C@H]1O)O)=O)O)O |
| InChI | 1S/C6H10O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2,4-7,9-11H,1H2/t2-,4+,5-,6-/m0/s1 |
| InChIKey | GZYCZKBRQBKGJW-YGIVHSIPSA-N |
| Density | 1.784g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.114°C at 760 mmHg (Cal.) |
| Flash point | 170.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxyinosose |