Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Hydroxychroman-2-One |
|---|---|
| Synonyms | 6-Hydroxy-2-Chromanone; 3,4-Dihydro-6-Hydroxy-2H-1-Benzopyran-2-One; 3,4-Dihydro-6-Hydroxycoumarin |
| Molecular Structure |  |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 |
| CAS Registry Number | 2669-94-5 |
| EINECS | 220-211-3 |
| SMILES | C1=C(O)C=C2C(=C1)OC(=O)CC2 |
| InChI | 1S/C9H8O3/c10-7-2-3-8-6(5-7)1-4-9(11)12-8/h2-3,5,10H,1,4H2 |
| InChIKey | ZCNZNVIRVHJXKV-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.464°C at 760 mmHg (Cal.) |
| Flash point | 166.207°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Hydroxychroman-2-One |