| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Furo[3,2-f][1]Benzofuran |
|---|---|
| Synonyms | benzo[1,2-b:5,4-b′]difuran; InChI=1/C10H6O2/c1-3-11-9-6-10-8(2-4-12-10)5-7(1)9/h1-6H |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.15 |
| CAS Registry Number | 267-56-1 |
| SMILES | C1=COC2=CC3=C(C=CO3)C=C21 |
| InChI | 1S/C10H6O2/c1-3-11-9-6-10-8(2-4-12-10)5-7(1)9/h1-6H |
| InChIKey | VRVRKRVJBOXCTA-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 35.7±7.0°C at 760 mmHg (Cal.) |
| Flash point | -52.8±5.0°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| (1) | Kwanghee Koh Park, Hongsan Lim, Sun-Hyuk Kim and Dae Hyun Bae. Synthesis of novel cyclophanes containing both benzo[1,2-b:5,4-b']difuran and naphthalene rings, J. Chem. Soc., Perkin Trans. 1, 2002, 0, 310. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Furo[3,2-f][1]Benzofuran |