| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Furo[2,3-f][1]Benzofuran |
|---|---|
| Synonyms | benzo[1,2-b:4,5-b′]difuran; Benzo[1,2-b:4,5-b′]difuran |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O2 |
| Molecular Weight | 158.15 |
| CAS Registry Number | 267-58-3 |
| SMILES | C1=COC2=CC3=C(C=C21)OC=C3 |
| InChI | 1S/C10H6O2/c1-3-11-9-6-8-2-4-12-10(8)5-7(1)9/h1-6H |
| InChIKey | MCNFETJREUYKBJ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.0±13.0°C at 760 mmHg (Cal.) |
| Flash point | 107.5±6.6°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| (1) | Lu Xiao, Bo Liu, Xuewen Chen, Yongfang Li, Wanjun Tang and Yingping Zou. Fluorine substituted benzothiazole-based low bandgap polymers for photovoltaic applications, RSC Advances, 2013, 3, 11869. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Furo[2,3-f][1]Benzofuran |